C33H45FN8O2 — CID 89125332
(2S)-N-[4-[2-[4-[4-[3-(dimethylamino)-2,2-dimethylpropyl]piperazin-1-yl]-3-fluoroanilino]pyrimidin-4-yl]phenyl]-2-formamidopentanamide (PubChem CID 89125332) has the molecular formula C33H45FN8O2 and a molecular weight of 604.78 g/mol. Its IUPAC name is (2S)-N-[4-[2-[4-[4-[3-(dimethylamino)-2,2-dimethylpropyl]piperazin-1-yl]-3-fluoroanilino]pyrimidin-4-yl]phenyl]-2-formamidopentanamide.
| Compound Name | (2S)-N-[4-[2-[4-[4-[3-(dimethylamino)-2,2-dimethylpropyl]piperazin-1-yl]-3-fluoroanilino]pyrimidin-4-yl]phenyl]-2-formamidopentanamide |
|---|---|
| PubChem CID | 89125332 |
| Molecular Formula | C33H45FN8O2 |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | (2S)-N-[4-[2-[4-[4-[3-(dimethylamino)-2,2-dimethylpropyl]piperazin-1-yl]-3-fluoroanilino]pyrimidin-4-yl]phenyl]-2-formamidopentanamide |
| SMILES | CCC[C@H](NC=O)C(=O)Nc1ccc(-c2ccnc(Nc3ccc(N4CCN(CC(C)(C)CN(C)C)CC4)c(F)c3)n2)cc1 |
| InChI | InChI=1S/C33H45FN8O2/c1-6-7-29(36-23-43)31(44)37-25-10-8-24(9-11-25)28-14-15-35-32(39-28)38-26-12-13-30(27(34)20-26)42-18-16-41(17-19-42)22-33(2,3)21-40(4)5/h8-15,20,23,29H,6-7,16-19,21-22H2,1-5H3,(H,36,43)(H,37,44)(H,35,38,39)/t29-/m0/s1 |
| InChIKey | FRGWFYOKTOJEAD-LJAQVGFWSA-N |
| XLogP | 4.59 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|