C21H22F4O2S — CID 89129159
1-[2-[4-[3,5-difluoro-4-(fluoromethyl)phenyl]-3-fluorophenyl]-1,3-dioxan-5-yl]butane-1-thiol (PubChem CID 89129159) has the molecular formula C21H22F4O2S and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-[2-[4-[3,5-difluoro-4-(fluoromethyl)phenyl]-3-fluorophenyl]-1,3-dioxan-5-yl]butane-1-thiol.
| Compound Name | 1-[2-[4-[3,5-difluoro-4-(fluoromethyl)phenyl]-3-fluorophenyl]-1,3-dioxan-5-yl]butane-1-thiol |
|---|---|
| PubChem CID | 89129159 |
| Molecular Formula | C21H22F4O2S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 1-[2-[4-[3,5-difluoro-4-(fluoromethyl)phenyl]-3-fluorophenyl]-1,3-dioxan-5-yl]butane-1-thiol |
| SMILES | CCCC(S)C1COC(c2ccc(-c3cc(F)c(CF)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C21H22F4O2S/c1-2-3-20(28)14-10-26-21(27-11-14)12-4-5-15(17(23)6-12)13-7-18(24)16(9-22)19(25)8-13/h4-8,14,20-21,28H,2-3,9-11H2,1H3 |
| InChIKey | GOYLRRIZRCEKJO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|