C18H24O9 — CID 89132880
tert-butyl 6-methyl-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-4-oxo-3,3a,6,6a-tetrahydro-2H-furo[2,3-c]furan-3-carboxylate (PubChem CID 89132880) has the molecular formula C18H24O9 and a molecular weight of 384.38 g/mol. Its IUPAC name is tert-butyl 6-methyl-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-4-oxo-3,3a,6,6a-tetrahydro-2H-furo[2,3-c]furan-3-carboxylate.
| Compound Name | tert-butyl 6-methyl-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-4-oxo-3,3a,6,6a-tetrahydro-2H-furo[2,3-c]furan-3-carboxylate |
|---|---|
| PubChem CID | 89132880 |
| Molecular Formula | C18H24O9 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | tert-butyl 6-methyl-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-4-oxo-3,3a,6,6a-tetrahydro-2H-furo[2,3-c]furan-3-carboxylate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1OC2C(C)OC(=O)C2C1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24O9/c1-8(2)14(20)23-7-10(19)25-17-12(16(22)27-18(4,5)6)11-13(26-17)9(3)24-15(11)21/h9,11-13,17H,1,7H2,2-6H3 |
| InChIKey | BXMIUNICVZBLJO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|