C14H18O7 — CID 89132886
[2-oxo-2-[(3,3,6-trimethyl-4-oxo-2,3a,6,6a-tetrahydrofuro[3,4-b]furan-2-yl)oxy]ethyl] prop-2-enoate (PubChem CID 89132886) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is [2-oxo-2-[(3,3,6-trimethyl-4-oxo-2,3a,6,6a-tetrahydrofuro[3,4-b]furan-2-yl)oxy]ethyl] prop-2-enoate.
| Compound Name | [2-oxo-2-[(3,3,6-trimethyl-4-oxo-2,3a,6,6a-tetrahydrofuro[3,4-b]furan-2-yl)oxy]ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 89132886 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [2-oxo-2-[(3,3,6-trimethyl-4-oxo-2,3a,6,6a-tetrahydrofuro[3,4-b]furan-2-yl)oxy]ethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)OC1OC2C(C)OC(=O)C2C1(C)C |
| InChI | InChI=1S/C14H18O7/c1-5-8(15)18-6-9(16)20-13-14(3,4)10-11(21-13)7(2)19-12(10)17/h5,7,10-11,13H,1,6H2,2-4H3 |
| InChIKey | RLQBIXAYEFPYGL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|