C14H18O7 — CID 89132889
[2-[(3-ethyl-6-methyl-4-oxo-3,3a,6,6a-tetrahydro-2H-furo[2,3-c]furan-2-yl)oxy]-2-oxoethyl] prop-2-enoate (PubChem CID 89132889) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is [2-[(3-ethyl-6-methyl-4-oxo-3,3a,6,6a-tetrahydro-2H-furo[2,3-c]furan-2-yl)oxy]-2-oxoethyl] prop-2-enoate.
| Compound Name | [2-[(3-ethyl-6-methyl-4-oxo-3,3a,6,6a-tetrahydro-2H-furo[2,3-c]furan-2-yl)oxy]-2-oxoethyl] prop-2-enoate |
|---|---|
| PubChem CID | 89132889 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [2-[(3-ethyl-6-methyl-4-oxo-3,3a,6,6a-tetrahydro-2H-furo[2,3-c]furan-2-yl)oxy]-2-oxoethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)OC1OC2C(C)OC(=O)C2C1CC |
| InChI | InChI=1S/C14H18O7/c1-4-8-11-12(7(3)19-13(11)17)21-14(8)20-10(16)6-18-9(15)5-2/h5,7-8,11-12,14H,2,4,6H2,1,3H3 |
| InChIKey | NYXWCIUFLAJKHL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|