C24H34N2O2 — CID 89135564
butyl N-[[4-(4-aminophenyl)-3-methylphenyl]methyl]-N-(3-methylbutyl)carbamate (PubChem CID 89135564) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is butyl N-[[4-(4-aminophenyl)-3-methylphenyl]methyl]-N-(3-methylbutyl)carbamate.
| Compound Name | butyl N-[[4-(4-aminophenyl)-3-methylphenyl]methyl]-N-(3-methylbutyl)carbamate |
|---|---|
| PubChem CID | 89135564 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | butyl N-[[4-(4-aminophenyl)-3-methylphenyl]methyl]-N-(3-methylbutyl)carbamate |
| SMILES | CCCCOC(=O)N(CCC(C)C)Cc1ccc(-c2ccc(N)cc2)c(C)c1 |
| InChI | InChI=1S/C24H34N2O2/c1-5-6-15-28-24(27)26(14-13-18(2)3)17-20-7-12-23(19(4)16-20)21-8-10-22(25)11-9-21/h7-12,16,18H,5-6,13-15,17,25H2,1-4H3 |
| InChIKey | ITLQLFSANHWTBI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|