C24H31FN2O5 — CID 70954809
butyl N-[[4-(4-carbamoyl-3-hydroxyphenoxy)-3-fluorophenyl]methyl]-N-(3-methylbutyl)carbamate (PubChem CID 70954809) has the molecular formula C24H31FN2O5 and a molecular weight of 446.52 g/mol. Its IUPAC name is butyl N-[[4-(4-carbamoyl-3-hydroxyphenoxy)-3-fluorophenyl]methyl]-N-(3-methylbutyl)carbamate.
| Compound Name | butyl N-[[4-(4-carbamoyl-3-hydroxyphenoxy)-3-fluorophenyl]methyl]-N-(3-methylbutyl)carbamate |
|---|---|
| PubChem CID | 70954809 |
| Molecular Formula | C24H31FN2O5 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | butyl N-[[4-(4-carbamoyl-3-hydroxyphenoxy)-3-fluorophenyl]methyl]-N-(3-methylbutyl)carbamate |
| SMILES | CCCCOC(=O)N(CCC(C)C)Cc1ccc(Oc2ccc(C(N)=O)c(O)c2)c(F)c1 |
| InChI | InChI=1S/C24H31FN2O5/c1-4-5-12-31-24(30)27(11-10-16(2)3)15-17-6-9-22(20(25)13-17)32-18-7-8-19(23(26)29)21(28)14-18/h6-9,13-14,16,28H,4-5,10-12,15H2,1-3H3,(H2,26,29) |
| InChIKey | KAAKBNQSKBSOQL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|