C11H15I — CID 89142716
4-(iodomethyl)-7-methyl-2,3,3a,4-tetrahydro-1H-indene (PubChem CID 89142716) has the molecular formula C11H15I and a molecular weight of 274.14 g/mol. Its IUPAC name is 4-(iodomethyl)-7-methyl-2,3,3a,4-tetrahydro-1H-indene.
| Compound Name | 4-(iodomethyl)-7-methyl-2,3,3a,4-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 89142716 |
| Molecular Formula | C11H15I |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 4-(iodomethyl)-7-methyl-2,3,3a,4-tetrahydro-1H-indene |
| SMILES | CC1=C2CCCC2C(CI)C=C1 |
| InChI | InChI=1S/C11H15I/c1-8-5-6-9(7-12)11-4-2-3-10(8)11/h5-6,9,11H,2-4,7H2,1H3 |
| InChIKey | WWBASEDHJQLMJR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|