C19H27BrO3Si — CID 89142821
(6S,7aS)-7-bromo-6-phenylmethoxy-2,2-di(propan-2-yl)-4,6,7,7a-tetrahydrocyclopenta[d][1,3,2]dioxasiline (PubChem CID 89142821) has the molecular formula C19H27BrO3Si and a molecular weight of 411.41 g/mol. Its IUPAC name is (6S,7aS)-7-bromo-6-phenylmethoxy-2,2-di(propan-2-yl)-4,6,7,7a-tetrahydrocyclopenta[d][1,3,2]dioxasiline.
| Compound Name | (6S,7aS)-7-bromo-6-phenylmethoxy-2,2-di(propan-2-yl)-4,6,7,7a-tetrahydrocyclopenta[d][1,3,2]dioxasiline |
|---|---|
| PubChem CID | 89142821 |
| Molecular Formula | C19H27BrO3Si |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (6S,7aS)-7-bromo-6-phenylmethoxy-2,2-di(propan-2-yl)-4,6,7,7a-tetrahydrocyclopenta[d][1,3,2]dioxasiline |
| SMILES | CC(C)[Si]1(C(C)C)OCC2=C[C@H](OCc3ccccc3)C(Br)[C@H]2O1 |
| InChI | InChI=1S/C19H27BrO3Si/c1-13(2)24(14(3)4)22-12-16-10-17(18(20)19(16)23-24)21-11-15-8-6-5-7-9-15/h5-10,13-14,17-19H,11-12H2,1-4H3/t17-,18?,19-/m0/s1 |
| InChIKey | ONLPIBPGVMPASY-JVUMBYKBSA-N |
| XLogP | 4.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|