C27H46O5Si2 — CID 86718973
(6aR,8S,9S,9aR)-8-phenylmethoxy-2,2,4,4-tetra(propan-2-yl)spiro[6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocine-7,1'-cyclopropane]-9-ol (PubChem CID 86718973) has the molecular formula C27H46O5Si2 and a molecular weight of 506.83 g/mol. Its IUPAC name is (6aR,8S,9S,9aR)-8-phenylmethoxy-2,2,4,4-tetra(propan-2-yl)spiro[6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocine-7,1'-cyclopropane]-9-ol.
| Compound Name | (6aR,8S,9S,9aR)-8-phenylmethoxy-2,2,4,4-tetra(propan-2-yl)spiro[6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocine-7,1'-cyclopropane]-9-ol |
|---|---|
| PubChem CID | 86718973 |
| Molecular Formula | C27H46O5Si2 |
| Molecular Weight | 506.83 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (6aR,8S,9S,9aR)-8-phenylmethoxy-2,2,4,4-tetra(propan-2-yl)spiro[6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocine-7,1'-cyclopropane]-9-ol |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@@H]2[C@@H](O[Si](C(C)C)(C(C)C)O1)[C@@H](O)[C@@H](OCc1ccccc1)C21CC1 |
| InChI | InChI=1S/C27H46O5Si2/c1-18(2)33(19(3)4)30-17-23-25(31-34(32-33,20(5)6)21(7)8)24(28)26(27(23)14-15-27)29-16-22-12-10-9-11-13-22/h9-13,18-21,23-26,28H,14-17H2,1-8H3/t23-,24-,25-,26-/m1/s1 |
| InChIKey | SWDKOBZDNQFOGA-VEYUFSJPSA-N |
| XLogP | 6.30 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.83 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|