C5H11BN2O2 — CID 89144758
4-methyl-2,6-dioxa-7-aza-1-borabicyclo[2.2.2]octan-7-amine (PubChem CID 89144758) has the molecular formula C5H11BN2O2 and a molecular weight of 141.97 g/mol. Its IUPAC name is 4-methyl-2,6-dioxa-7-aza-1-borabicyclo[2.2.2]octan-7-amine.
| Compound Name | 4-methyl-2,6-dioxa-7-aza-1-borabicyclo[2.2.2]octan-7-amine |
|---|---|
| PubChem CID | 89144758 |
| Molecular Formula | C5H11BN2O2 |
| Molecular Weight | 141.97 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 4-methyl-2,6-dioxa-7-aza-1-borabicyclo[2.2.2]octan-7-amine |
| SMILES | CC12COB(OC1)N(N)C2 |
| InChI | InChI=1S/C5H11BN2O2/c1-5-2-8(7)6(9-3-5)10-4-5/h2-4,7H2,1H3 |
| InChIKey | UCVZALXFKSLCGP-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.97 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|