C2H8N4 — CID 139945777
aziridine-1,2,2-triamine (PubChem CID 139945777) has the molecular formula C2H8N4 and a molecular weight of 88.11 g/mol. Its IUPAC name is aziridine-1,2,2-triamine.
| Compound Name | aziridine-1,2,2-triamine |
|---|---|
| PubChem CID | 139945777 |
| Molecular Formula | C2H8N4 |
| Molecular Weight | 88.11 g/mol |
| Exact Mass | 88.07 |
| IUPAC Name | aziridine-1,2,2-triamine |
| SMILES | NN1CC1(N)N |
| InChI | InChI=1S/C2H8N4/c3-2(4)1-6(2)5/h1,3-5H2 |
| InChIKey | DLSNXHVXFIIHPU-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 88.11 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|