C18H14ClF3N2O2 — CID 89149963
(Z)-4-[N-amino-3-(trifluoromethyl)anilino]-4-(3-chlorophenyl)-2-methylidenebut-3-enoic acid (PubChem CID 89149963) has the molecular formula C18H14ClF3N2O2 and a molecular weight of 382.77 g/mol. Its IUPAC name is (Z)-4-[N-amino-3-(trifluoromethyl)anilino]-4-(3-chlorophenyl)-2-methylidenebut-3-enoic acid.
| Compound Name | (Z)-4-[N-amino-3-(trifluoromethyl)anilino]-4-(3-chlorophenyl)-2-methylidenebut-3-enoic acid |
|---|---|
| PubChem CID | 89149963 |
| Molecular Formula | C18H14ClF3N2O2 |
| Molecular Weight | 382.77 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (Z)-4-[N-amino-3-(trifluoromethyl)anilino]-4-(3-chlorophenyl)-2-methylidenebut-3-enoic acid |
| SMILES | C=C(/C=C(/c1cccc(Cl)c1)N(N)c1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C18H14ClF3N2O2/c1-11(17(25)26)8-16(12-4-2-6-14(19)9-12)24(23)15-7-3-5-13(10-15)18(20,21)22/h2-10H,1,23H2,(H,25,26)/b16-8- |
| InChIKey | DQUHSNRSQDVGPH-PXNMLYILSA-N |
| XLogP | 4.72 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.77 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|