C7H12N4 — CID 89151158
4-[(3R)-5-methylpyrrolidin-3-yl]-1,2,4-triazole (PubChem CID 89151158) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 4-[(3R)-5-methylpyrrolidin-3-yl]-1,2,4-triazole.
| Compound Name | 4-[(3R)-5-methylpyrrolidin-3-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 89151158 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 4-[(3R)-5-methylpyrrolidin-3-yl]-1,2,4-triazole |
| SMILES | CC1C[C@@H](n2cnnc2)CN1 |
| InChI | InChI=1S/C7H12N4/c1-6-2-7(3-8-6)11-4-9-10-5-11/h4-8H,2-3H2,1H3/t6?,7-/m1/s1 |
| InChIKey | NKBVIMKZIAKMTR-COBSHVIPSA-N |
| XLogP | 0.20 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |