C29H36O6 — CID 89153345
prop-2-enyl 2-methyl-2-[4-[2-[4-(2-methyl-2-prop-2-enoxypropanoyl)oxyphenyl]propan-2-yl]phenoxy]propanoate (PubChem CID 89153345) has the molecular formula C29H36O6 and a molecular weight of 480.60 g/mol. Its IUPAC name is prop-2-enyl 2-methyl-2-[4-[2-[4-(2-methyl-2-prop-2-enoxypropanoyl)oxyphenyl]propan-2-yl]phenoxy]propanoate.
| Compound Name | prop-2-enyl 2-methyl-2-[4-[2-[4-(2-methyl-2-prop-2-enoxypropanoyl)oxyphenyl]propan-2-yl]phenoxy]propanoate |
|---|---|
| PubChem CID | 89153345 |
| Molecular Formula | C29H36O6 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | prop-2-enyl 2-methyl-2-[4-[2-[4-(2-methyl-2-prop-2-enoxypropanoyl)oxyphenyl]propan-2-yl]phenoxy]propanoate |
| SMILES | C=CCOC(=O)C(C)(C)Oc1ccc(C(C)(C)c2ccc(OC(=O)C(C)(C)OCC=C)cc2)cc1 |
| InChI | InChI=1S/C29H36O6/c1-9-19-32-25(30)29(7,8)35-24-17-13-22(14-18-24)27(3,4)21-11-15-23(16-12-21)34-26(31)28(5,6)33-20-10-2/h9-18H,1-2,19-20H2,3-8H3 |
| InChIKey | IKLQBWPXQZKESL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|