C17H17F15 — CID 89153555
4-[2-[3,4-bis(trifluoromethyl)cyclopentyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1-methyl-2-(trifluoromethyl)cyclopentane (PubChem CID 89153555) has the molecular formula C17H17F15 and a molecular weight of 506.29 g/mol. Its IUPAC name is 4-[2-[3,4-bis(trifluoromethyl)cyclopentyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1-methyl-2-(trifluoromethyl)cyclopentane.
| Compound Name | 4-[2-[3,4-bis(trifluoromethyl)cyclopentyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1-methyl-2-(trifluoromethyl)cyclopentane |
|---|---|
| PubChem CID | 89153555 |
| Molecular Formula | C17H17F15 |
| Molecular Weight | 506.29 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 4-[2-[3,4-bis(trifluoromethyl)cyclopentyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1-methyl-2-(trifluoromethyl)cyclopentane |
| SMILES | CC1CC(C(C2CC(C(F)(F)F)C(C(F)(F)F)C2)(C(F)(F)F)C(F)(F)F)CC1C(F)(F)F |
| InChI | InChI=1S/C17H17F15/c1-6-2-7(3-9(6)13(18,19)20)12(16(27,28)29,17(30,31)32)8-4-10(14(21,22)23)11(5-8)15(24,25)26/h6-11H,2-5H2,1H3 |
| InChIKey | HZOILCUXYCASPM-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.29 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |