C21H20O3S — CID 89153690
3-phenylpropanoyl 4-methyl-2-phenyl-2,3-dihydrothiophene-5-carboxylate (PubChem CID 89153690) has the molecular formula C21H20O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-phenylpropanoyl 4-methyl-2-phenyl-2,3-dihydrothiophene-5-carboxylate.
| Compound Name | 3-phenylpropanoyl 4-methyl-2-phenyl-2,3-dihydrothiophene-5-carboxylate |
|---|---|
| PubChem CID | 89153690 |
| Molecular Formula | C21H20O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 3-phenylpropanoyl 4-methyl-2-phenyl-2,3-dihydrothiophene-5-carboxylate |
| SMILES | CC1=C(C(=O)OC(=O)CCc2ccccc2)SC(c2ccccc2)C1 |
| InChI | InChI=1S/C21H20O3S/c1-15-14-18(17-10-6-3-7-11-17)25-20(15)21(23)24-19(22)13-12-16-8-4-2-5-9-16/h2-11,18H,12-14H2,1H3 |
| InChIKey | UAIIYMLGHSINGC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|