C30H38N2O8 — CID 89155618
bis[4-(butylaminooxycarbonyl)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 89155618) has the molecular formula C30H38N2O8 and a molecular weight of 554.64 g/mol. Its IUPAC name is bis[4-(butylaminooxycarbonyl)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | bis[4-(butylaminooxycarbonyl)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 89155618 |
| Molecular Formula | C30H38N2O8 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | bis[4-(butylaminooxycarbonyl)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | CCCCNOC(=O)c1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(C(=O)ONCCCC)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H38N2O8/c1-3-5-19-31-39-29(35)23-11-15-25(16-12-23)37-27(33)21-7-9-22(10-8-21)28(34)38-26-17-13-24(14-18-26)30(36)40-32-20-6-4-2/h11-18,21-22,31-32H,3-10,19-20H2,1-2H3 |
| InChIKey | RXIAFCRYBWKTEU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|