C17H22NO3P — CID 89161116
1-cyclopenta-1,3-dien-1-yl-N-[4-(diethoxyphosphorylmethyl)phenyl]methanimine (PubChem CID 89161116) has the molecular formula C17H22NO3P and a molecular weight of 319.34 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-N-[4-(diethoxyphosphorylmethyl)phenyl]methanimine.
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-N-[4-(diethoxyphosphorylmethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 89161116 |
| Molecular Formula | C17H22NO3P |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-N-[4-(diethoxyphosphorylmethyl)phenyl]methanimine |
| SMILES | CCOP(=O)(Cc1ccc(/N=C/C2=CC=CC2)cc1)OCC |
| InChI | InChI=1S/C17H22NO3P/c1-3-20-22(19,21-4-2)14-16-9-11-17(12-10-16)18-13-15-7-5-6-8-15/h5-7,9-13H,3-4,8,14H2,1-2H3/b18-13+ |
| InChIKey | KWZPTFVOMUAOSF-QGOAFFKASA-N |
| XLogP | 5.04 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|