C13H14N2O4 — CID 89168313
2-[acetyl-[(1E,3E)-4-cyano-5-oxopenta-1,3-dienyl]amino]ethyl prop-2-enoate (PubChem CID 89168313) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-[acetyl-[(1E,3E)-4-cyano-5-oxopenta-1,3-dienyl]amino]ethyl prop-2-enoate.
| Compound Name | 2-[acetyl-[(1E,3E)-4-cyano-5-oxopenta-1,3-dienyl]amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 89168313 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-[acetyl-[(1E,3E)-4-cyano-5-oxopenta-1,3-dienyl]amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(/C=C/C=C(\C#N)C=O)C(C)=O |
| InChI | InChI=1S/C13H14N2O4/c1-3-13(18)19-8-7-15(11(2)17)6-4-5-12(9-14)10-16/h3-6,10H,1,7-8H2,2H3/b6-4+,12-5+ |
| InChIKey | GEQGHGVWEIHSJK-ZCGKFZJYSA-N |
| XLogP | 0.73 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|