C14H11BrClNO2 — CID 891695
3-(4-bromo-2-chloroanilino)-1-(5-methylfuran-2-yl)prop-2-en-1-one (PubChem CID 891695) has the molecular formula C14H11BrClNO2 and a molecular weight of 340.60 g/mol. Its IUPAC name is 3-(4-bromo-2-chloroanilino)-1-(5-methylfuran-2-yl)prop-2-en-1-one.
| Compound Name | 3-(4-bromo-2-chloroanilino)-1-(5-methylfuran-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 891695 |
| Molecular Formula | C14H11BrClNO2 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 3-(4-bromo-2-chloroanilino)-1-(5-methylfuran-2-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)C=CNc2ccc(Br)cc2Cl)o1 |
| InChI | InChI=1S/C14H11BrClNO2/c1-9-2-5-14(19-9)13(18)6-7-17-12-4-3-10(15)8-11(12)16/h2-8,17H,1H3 |
| InChIKey | FKSRKCIBOKTMHH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|