C24H43N3O2S2 — CID 89171228
4-[3-[4-[(4-tert-butylphenyl)methyl-methylsulfanylamino]butyl-methylsulfanylamino]propylamino]butanoic acid (PubChem CID 89171228) has the molecular formula C24H43N3O2S2 and a molecular weight of 469.76 g/mol. Its IUPAC name is 4-[3-[4-[(4-tert-butylphenyl)methyl-methylsulfanylamino]butyl-methylsulfanylamino]propylamino]butanoic acid.
| Compound Name | 4-[3-[4-[(4-tert-butylphenyl)methyl-methylsulfanylamino]butyl-methylsulfanylamino]propylamino]butanoic acid |
|---|---|
| PubChem CID | 89171228 |
| Molecular Formula | C24H43N3O2S2 |
| Molecular Weight | 469.76 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | 4-[3-[4-[(4-tert-butylphenyl)methyl-methylsulfanylamino]butyl-methylsulfanylamino]propylamino]butanoic acid |
| SMILES | CSN(CCCCN(Cc1ccc(C(C)(C)C)cc1)SC)CCCNCCCC(=O)O |
| InChI | InChI=1S/C24H43N3O2S2/c1-24(2,3)22-13-11-21(12-14-22)20-27(31-5)18-7-6-17-26(30-4)19-9-16-25-15-8-10-23(28)29/h11-14,25H,6-10,15-20H2,1-5H3,(H,28,29) |
| InChIKey | BEZGAIRODSMEGL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.76 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|