C27H22Cl2F3N3O2 — CID 89175021
5-(4-chlorocyclohexa-1,5-dien-1-yl)-1-(2-chlorophenyl)-4-(2-oxoethyl)-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazole-3-carboxamide (PubChem CID 89175021) has the molecular formula C27H22Cl2F3N3O2 and a molecular weight of 548.39 g/mol. Its IUPAC name is 5-(4-chlorocyclohexa-1,5-dien-1-yl)-1-(2-chlorophenyl)-4-(2-oxoethyl)-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazole-3-carboxamide.
| Compound Name | 5-(4-chlorocyclohexa-1,5-dien-1-yl)-1-(2-chlorophenyl)-4-(2-oxoethyl)-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 89175021 |
| Molecular Formula | C27H22Cl2F3N3O2 |
| Molecular Weight | 548.39 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 5-(4-chlorocyclohexa-1,5-dien-1-yl)-1-(2-chlorophenyl)-4-(2-oxoethyl)-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazole-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1nn(-c2ccccc2Cl)c(C2=CCC(Cl)C=C2)c1CC=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H22Cl2F3N3O2/c1-16(17-6-10-19(11-7-17)27(30,31)32)33-26(37)24-21(14-15-36)25(18-8-12-20(28)13-9-18)35(34-24)23-5-3-2-4-22(23)29/h2-12,15-16,20H,13-14H2,1H3,(H,33,37)/t16-,20?/m1/s1 |
| InChIKey | ZSPJNRLOTRVDFW-QRIPLOBPSA-N |
| XLogP | 6.73 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.39 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|