C27H25I — CID 89176920
(7Z,9Z)-3-(4-iodonaphthalen-1-yl)-5,5,6-trimethyl-11-methylidene-6H-benzo[9]annulene (PubChem CID 89176920) has the molecular formula C27H25I and a molecular weight of 476.40 g/mol. Its IUPAC name is (7Z,9Z)-3-(4-iodonaphthalen-1-yl)-5,5,6-trimethyl-11-methylidene-6H-benzo[9]annulene.
| Compound Name | (7Z,9Z)-3-(4-iodonaphthalen-1-yl)-5,5,6-trimethyl-11-methylidene-6H-benzo[9]annulene |
|---|---|
| PubChem CID | 89176920 |
| Molecular Formula | C27H25I |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | (7Z,9Z)-3-(4-iodonaphthalen-1-yl)-5,5,6-trimethyl-11-methylidene-6H-benzo[9]annulene |
| SMILES | C=C1/C=C\C=C/C(C)C(C)(C)c2cc(-c3ccc(I)c4ccccc34)ccc21 |
| InChI | InChI=1S/C27H25I/c1-18-9-5-6-10-19(2)27(3,4)25-17-20(13-14-21(18)25)22-15-16-26(28)24-12-8-7-11-23(22)24/h5-17,19H,1H2,2-4H3/b9-5-,10-6- |
| InChIKey | AHZWBFBWBZTDDN-OZDSWYPASA-N |
| XLogP | 8.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|