C12H15BrO6 — CID 89180518
[(1R,2R,6R,8S)-4,4-dimethyl-9-oxo-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-8-yl] 2-bromoacetate (PubChem CID 89180518) has the molecular formula C12H15BrO6 and a molecular weight of 335.15 g/mol. Its IUPAC name is [(1R,2R,6R,8S)-4,4-dimethyl-9-oxo-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-8-yl] 2-bromoacetate.
| Compound Name | [(1R,2R,6R,8S)-4,4-dimethyl-9-oxo-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-8-yl] 2-bromoacetate |
|---|---|
| PubChem CID | 89180518 |
| Molecular Formula | C12H15BrO6 |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | [(1R,2R,6R,8S)-4,4-dimethyl-9-oxo-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-8-yl] 2-bromoacetate |
| SMILES | CC1(C)O[C@H]2[C@H]3C[C@@](OC(=O)CBr)(C[C@H]2O1)C(=O)O3 |
| InChI | InChI=1S/C12H15BrO6/c1-11(2)17-7-4-12(18-8(14)5-13)3-6(9(7)19-11)16-10(12)15/h6-7,9H,3-5H2,1-2H3/t6-,7-,9+,12-/m1/s1 |
| InChIKey | QFIMLPNKOBXEAK-PNFUHCLESA-N |
| XLogP | 0.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|