C33H31BrO8 — CID 89180760
methyl 2-[2-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-bromomethyl]-1,3-benzodioxol-5-yl]acetate (PubChem CID 89180760) has the molecular formula C33H31BrO8 and a molecular weight of 635.51 g/mol. Its IUPAC name is methyl 2-[2-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-bromomethyl]-1,3-benzodioxol-5-yl]acetate.
| Compound Name | methyl 2-[2-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-bromomethyl]-1,3-benzodioxol-5-yl]acetate |
|---|---|
| PubChem CID | 89180760 |
| Molecular Formula | C33H31BrO8 |
| Molecular Weight | 635.51 g/mol |
| Exact Mass | 634.12 |
| IUPAC Name | methyl 2-[2-[[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-bromomethyl]-1,3-benzodioxol-5-yl]acetate |
| SMILES | COC(=O)Cc1ccc2c(c1)OC(C(Br)c1ccc(OCc3ccc(OC)cc3)c(OCc3ccc(OC)cc3)c1)O2 |
| InChI | InChI=1S/C33H31BrO8/c1-36-25-10-4-21(5-11-25)19-39-27-15-9-24(18-29(27)40-20-22-6-12-26(37-2)13-7-22)32(34)33-41-28-14-8-23(16-30(28)42-33)17-31(35)38-3/h4-16,18,32-33H,17,19-20H2,1-3H3 |
| InChIKey | QSLFTZMYUAJVTR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|