C26H27NO2 — CID 89180965
N-[(4-methoxyphenyl)methyl]-N-[(2S)-1-(4-phenylphenyl)pent-4-en-2-yl]formamide (PubChem CID 89180965) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-N-[(2S)-1-(4-phenylphenyl)pent-4-en-2-yl]formamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-N-[(2S)-1-(4-phenylphenyl)pent-4-en-2-yl]formamide |
|---|---|
| PubChem CID | 89180965 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-N-[(2S)-1-(4-phenylphenyl)pent-4-en-2-yl]formamide |
| SMILES | C=CC[C@@H](Cc1ccc(-c2ccccc2)cc1)N(C=O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H27NO2/c1-3-7-25(27(20-28)19-22-12-16-26(29-2)17-13-22)18-21-10-14-24(15-11-21)23-8-5-4-6-9-23/h3-6,8-17,20,25H,1,7,18-19H2,2H3/t25-/m0/s1 |
| InChIKey | JZOQJBVLIZKPSQ-VWLOTQADSA-N |
| XLogP | 5.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|