C81H70N4O8 — CID 89183056
2-N,2-N,2-N',2-N',7-N,7-N,7-N',7-N'-octakis(4-methoxyphenyl)spiro[4a,9a-dihydrofluorene-9,9'-fluorene]-2,2',7,7'-tetramine (PubChem CID 89183056) has the molecular formula C81H70N4O8 and a molecular weight of 1227.47 g/mol. Its IUPAC name is 2-N,2-N,2-N',2-N',7-N,7-N,7-N',7-N'-octakis(4-methoxyphenyl)spiro[4a,9a-dihydrofluorene-9,9'-fluorene]-2,2',7,7'-tetramine.
| Compound Name | 2-N,2-N,2-N',2-N',7-N,7-N,7-N',7-N'-octakis(4-methoxyphenyl)spiro[4a,9a-dihydrofluorene-9,9'-fluorene]-2,2',7,7'-tetramine |
|---|---|
| PubChem CID | 89183056 |
| Molecular Formula | C81H70N4O8 |
| Molecular Weight | 1227.47 g/mol |
| Exact Mass | 1226.52 |
| IUPAC Name | 2-N,2-N,2-N',2-N',7-N,7-N,7-N',7-N'-octakis(4-methoxyphenyl)spiro[4a,9a-dihydrofluorene-9,9'-fluorene]-2,2',7,7'-tetramine |
| SMILES | COc1ccc(N(C2=CC3C(C=C2)c2ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc2C32c3cc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)ccc3-c3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc32)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C81H70N4O8/c1-86-65-29-9-53(10-30-65)82(54-11-31-66(87-2)32-12-54)61-25-45-73-74-46-26-62(83(55-13-33-67(88-3)34-14-55)56-15-35-68(89-4)36-16-56)50-78(74)81(77(73)49-61)79-51-63(84(57-17-37-69(90-5)38-18-57)58-19-39-70(91-6)40-20-58)27-47-75(79)76-48-28-64(52-80(76)81)85(59-21-41-71(92-7)42-22-59)60-23-43-72(93-8)44-24-60/h9-52,73,77H,1-8H3 |
| InChIKey | CLSGZTNFENZMHF-UHFFFAOYSA-N |
| XLogP | 19.49 |
| TPSA | 86.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 93 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1227.47 |
| LogP ≤ 5 | 19.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |