C28H36N2O4 — CID 89184938
cyclohexyl 2-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methoxy]acetate (PubChem CID 89184938) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is cyclohexyl 2-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methoxy]acetate.
| Compound Name | cyclohexyl 2-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methoxy]acetate |
|---|---|
| PubChem CID | 89184938 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | cyclohexyl 2-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methoxy]acetate |
| SMILES | C=CC1CN2CCC1CC2[C@@H](OCC(=O)OC1CCCCC1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C28H36N2O4/c1-3-19-17-30-14-12-20(19)15-26(30)28(33-18-27(31)34-21-7-5-4-6-8-21)23-11-13-29-25-10-9-22(32-2)16-24(23)25/h3,9-11,13,16,19-21,26,28H,1,4-8,12,14-15,17-18H2,2H3/t19?,20?,26?,28-/m0/s1 |
| InChIKey | NQHBJHHMWZDPRB-LFSRYFNOSA-N |
| XLogP | 5.07 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|