C24H44O4 — CID 89185633
2,2-dimethyl-4-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]-4-oxohexan-2-yl]oxynon-8-en-3-one (PubChem CID 89185633) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is 2,2-dimethyl-4-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]-4-oxohexan-2-yl]oxynon-8-en-3-one.
| Compound Name | 2,2-dimethyl-4-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]-4-oxohexan-2-yl]oxynon-8-en-3-one |
|---|---|
| PubChem CID | 89185633 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | 2,2-dimethyl-4-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]-4-oxohexan-2-yl]oxynon-8-en-3-one |
| SMILES | C=CCCCC(OC(C)(C)C(C)(C)C(=O)C(C)OC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C24H44O4/c1-13-14-15-16-18(20(26)21(3,4)5)28-24(11,12)23(9,10)19(25)17(2)27-22(6,7)8/h13,17-18H,1,14-16H2,2-12H3 |
| InChIKey | DPPRXCORJXMFDI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|