C27H36N4O2 — CID 89187839
(2S)-6-amino-N-[(2S)-1-(1H-indol-3-yl)-3-oxopropan-2-yl]-2-(4-phenylbutan-2-ylamino)hexanamide (PubChem CID 89187839) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is (2S)-6-amino-N-[(2S)-1-(1H-indol-3-yl)-3-oxopropan-2-yl]-2-(4-phenylbutan-2-ylamino)hexanamide.
| Compound Name | (2S)-6-amino-N-[(2S)-1-(1H-indol-3-yl)-3-oxopropan-2-yl]-2-(4-phenylbutan-2-ylamino)hexanamide |
|---|---|
| PubChem CID | 89187839 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (2S)-6-amino-N-[(2S)-1-(1H-indol-3-yl)-3-oxopropan-2-yl]-2-(4-phenylbutan-2-ylamino)hexanamide |
| SMILES | CC(CCc1ccccc1)N[C@@H](CCCCN)C(=O)N[C@H](C=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H36N4O2/c1-20(14-15-21-9-3-2-4-10-21)30-26(13-7-8-16-28)27(33)31-23(19-32)17-22-18-29-25-12-6-5-11-24(22)25/h2-6,9-12,18-20,23,26,29-30H,7-8,13-17,28H2,1H3,(H,31,33)/t20?,23-,26-/m0/s1 |
| InChIKey | JEYKNLGCZVXXDQ-KINFRSPJSA-N |
| XLogP | 3.50 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|