C24H48NO4P — CID 89187958
(Z)-N-(2-diethoxyphosphorylethyl)-2-hexyldodec-3-enamide (PubChem CID 89187958) has the molecular formula C24H48NO4P and a molecular weight of 445.63 g/mol. Its IUPAC name is (Z)-N-(2-diethoxyphosphorylethyl)-2-hexyldodec-3-enamide.
| Compound Name | (Z)-N-(2-diethoxyphosphorylethyl)-2-hexyldodec-3-enamide |
|---|---|
| PubChem CID | 89187958 |
| Molecular Formula | C24H48NO4P |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.33 |
| IUPAC Name | (Z)-N-(2-diethoxyphosphorylethyl)-2-hexyldodec-3-enamide |
| SMILES | CCCCCCCC/C=C\C(CCCCCC)C(=O)NCCP(=O)(OCC)OCC |
| InChI | InChI=1S/C24H48NO4P/c1-5-9-11-13-14-15-16-18-20-23(19-17-12-10-6-2)24(26)25-21-22-30(27,28-7-3)29-8-4/h18,20,23H,5-17,19,21-22H2,1-4H3,(H,25,26)/b20-18- |
| InChIKey | HATUQLBYSZNXBD-ZZEZOPTASA-N |
| XLogP | 7.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|