C20H19ClN3O4+ — CID 8918938
[(1S)-2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8918938) has the molecular formula C20H19ClN3O4+ and a molecular weight of 400.84 g/mol. Its IUPAC name is [(1S)-2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [(1S)-2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8918938 |
| Molecular Formula | C20H19ClN3O4+ |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [(1S)-2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
| SMILES | C[C@@H]([NH2+][C@H](C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C20H18ClN3O4/c1-13(18-8-5-11-28-18)22-19(14-6-3-2-4-7-14)20(25)23-15-9-10-16(21)17(12-15)24(26)27/h2-13,19,22H,1H3,(H,23,25)/p+1/t13-,19+/m1/s1 |
| InChIKey | JLHLWPIDDPZHGV-YJYMSZOUSA-O |
| XLogP | 3.85 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|