C27H48O8Si — CID 89190763
[(2R,4R,5R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]methyl]-5-hydroxy-4-(hydroxymethyl)-3,7-dioxononyl] acetate (PubChem CID 89190763) has the molecular formula C27H48O8Si and a molecular weight of 528.76 g/mol. Its IUPAC name is [(2R,4R,5R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]methyl]-5-hydroxy-4-(hydroxymethyl)-3,7-dioxononyl] acetate.
| Compound Name | [(2R,4R,5R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]methyl]-5-hydroxy-4-(hydroxymethyl)-3,7-dioxononyl] acetate |
|---|---|
| PubChem CID | 89190763 |
| Molecular Formula | C27H48O8Si |
| Molecular Weight | 528.76 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | [(2R,4R,5R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]methyl]-5-hydroxy-4-(hydroxymethyl)-3,7-dioxononyl] acetate |
| SMILES | C/C=C\[C@H](C)[C@H]1OC1(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](COC(C)=O)C(=O)[C@H](CO)[C@H](O)CC(=O)CC |
| InChI | InChI=1S/C27H48O8Si/c1-11-13-17(3)24-27(8,34-24)25(35-36(9,10)26(5,6)7)21(16-33-18(4)29)23(32)20(15-28)22(31)14-19(30)12-2/h11,13,17,20-22,24-25,28,31H,12,14-16H2,1-10H3/b13-11-/t17-,20+,21-,22+,24+,25-,27?/m0/s1 |
| InChIKey | NREJLZZXOKCGPW-NZVKVLQQSA-N |
| XLogP | 3.83 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.76 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|