C25H46O7Si — CID 90813172
(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(3R,4R)-6-ethyl-4,6-dihydroxyoxan-3-yl]-2-(hydroxymethyl)-3-[(3R)-2-methyl-3-[(2S)-pent-3-en-2-yl]oxiran-2-yl]propan-1-one (PubChem CID 90813172) has the molecular formula C25H46O7Si and a molecular weight of 486.72 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(3R,4R)-6-ethyl-4,6-dihydroxyoxan-3-yl]-2-(hydroxymethyl)-3-[(3R)-2-methyl-3-[(2S)-pent-3-en-2-yl]oxiran-2-yl]propan-1-one.
| Compound Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(3R,4R)-6-ethyl-4,6-dihydroxyoxan-3-yl]-2-(hydroxymethyl)-3-[(3R)-2-methyl-3-[(2S)-pent-3-en-2-yl]oxiran-2-yl]propan-1-one |
|---|---|
| PubChem CID | 90813172 |
| Molecular Formula | C25H46O7Si |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(3R,4R)-6-ethyl-4,6-dihydroxyoxan-3-yl]-2-(hydroxymethyl)-3-[(3R)-2-methyl-3-[(2S)-pent-3-en-2-yl]oxiran-2-yl]propan-1-one |
| SMILES | CC=C[C@H](C)[C@H]1OC1(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)C(=O)[C@@H]1COC(O)(CC)C[C@H]1O |
| InChI | InChI=1S/C25H46O7Si/c1-10-12-16(3)21-24(7,31-21)22(32-33(8,9)23(4,5)6)17(14-26)20(28)18-15-30-25(29,11-2)13-19(18)27/h10,12,16-19,21-22,26-27,29H,11,13-15H2,1-9H3/t16-,17-,18+,19+,21+,22-,24?,25?/m0/s1 |
| InChIKey | WETJQGIWHMIMAA-NFVCCGHESA-N |
| XLogP | 3.42 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|