C25H30F3N3 — CID 89191328
2-[1-(2-ethylphenyl)ethenylimino]-2-[4-(2-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 89191328) has the molecular formula C25H30F3N3 and a molecular weight of 429.53 g/mol. Its IUPAC name is 2-[1-(2-ethylphenyl)ethenylimino]-2-[4-(2-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-[1-(2-ethylphenyl)ethenylimino]-2-[4-(2-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 89191328 |
| Molecular Formula | C25H30F3N3 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-[1-(2-ethylphenyl)ethenylimino]-2-[4-(2-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | C=C(/N=C(\CN)c1ccc(N2CCCCC2C)c(C(F)(F)F)c1)c1ccccc1CC |
| InChI | InChI=1S/C25H30F3N3/c1-4-19-10-5-6-11-21(19)18(3)30-23(16-29)20-12-13-24(22(15-20)25(26,27)28)31-14-8-7-9-17(31)2/h5-6,10-13,15,17H,3-4,7-9,14,16,29H2,1-2H3/b30-23+ |
| InChIKey | ZLXYYIBPPKLUBX-JJKYIXSRSA-N |
| XLogP | 6.07 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|