C24H26F4N2O2 — CID 143784340
(E)-1-(5-fluoro-2-methoxyphenyl)-N-[1-[4-(2-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]ethenoxy]ethanimine (PubChem CID 143784340) has the molecular formula C24H26F4N2O2 and a molecular weight of 450.48 g/mol. Its IUPAC name is (E)-1-(5-fluoro-2-methoxyphenyl)-N-[1-[4-(2-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]ethenoxy]ethanimine.
| Compound Name | (E)-1-(5-fluoro-2-methoxyphenyl)-N-[1-[4-(2-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]ethenoxy]ethanimine |
|---|---|
| PubChem CID | 143784340 |
| Molecular Formula | C24H26F4N2O2 |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (E)-1-(5-fluoro-2-methoxyphenyl)-N-[1-[4-(2-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]ethenoxy]ethanimine |
| SMILES | C=C(O/N=C(\C)c1cc(F)ccc1OC)c1ccc(N2CCCCC2C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H26F4N2O2/c1-15-7-5-6-12-30(15)22-10-8-18(13-21(22)24(26,27)28)17(3)32-29-16(2)20-14-19(25)9-11-23(20)31-4/h8-11,13-15H,3,5-7,12H2,1-2,4H3/b29-16+ |
| InChIKey | VECHMADESCOXCK-MUFRIFMGSA-N |
| XLogP | 6.64 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|