C20H16F2N4O4 — CID 89197496
(5R)-5-[[5-(difluoromethoxy)-3-oxo-1H-isoindol-2-yl]methyl]-5-(1-pyridin-3-ylethenyl)imidazolidine-2,4-dione (PubChem CID 89197496) has the molecular formula C20H16F2N4O4 and a molecular weight of 414.37 g/mol. Its IUPAC name is (5R)-5-[[5-(difluoromethoxy)-3-oxo-1H-isoindol-2-yl]methyl]-5-(1-pyridin-3-ylethenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[[5-(difluoromethoxy)-3-oxo-1H-isoindol-2-yl]methyl]-5-(1-pyridin-3-ylethenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 89197496 |
| Molecular Formula | C20H16F2N4O4 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (5R)-5-[[5-(difluoromethoxy)-3-oxo-1H-isoindol-2-yl]methyl]-5-(1-pyridin-3-ylethenyl)imidazolidine-2,4-dione |
| SMILES | C=C(c1cccnc1)[C@]1(CN2Cc3ccc(OC(F)F)cc3C2=O)NC(=O)NC1=O |
| InChI | InChI=1S/C20H16F2N4O4/c1-11(12-3-2-6-23-8-12)20(17(28)24-19(29)25-20)10-26-9-13-4-5-14(30-18(21)22)7-15(13)16(26)27/h2-8,18H,1,9-10H2,(H2,24,25,28,29)/t20-/m0/s1 |
| InChIKey | XBQSCHGXAZFMNW-FQEVSTJZSA-N |
| XLogP | 1.93 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|