C16H28N2O5 — CID 89198316
methyl (E,2S)-2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxobutyl]amino]hex-4-enoate (PubChem CID 89198316) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is methyl (E,2S)-2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxobutyl]amino]hex-4-enoate.
| Compound Name | methyl (E,2S)-2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxobutyl]amino]hex-4-enoate |
|---|---|
| PubChem CID | 89198316 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | methyl (E,2S)-2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxobutyl]amino]hex-4-enoate |
| SMILES | C/C=C/C[C@H](NCCC(=O)CNC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C16H28N2O5/c1-6-7-8-13(14(20)22-5)17-10-9-12(19)11-18-15(21)23-16(2,3)4/h6-7,13,17H,8-11H2,1-5H3,(H,18,21)/b7-6+/t13-/m0/s1 |
| InChIKey | DDHZQFVLLHCHEE-YBJDMEARSA-N |
| XLogP | 1.57 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|