C19H18N4O4 — CID 89200760
benzyl 4-(4-nitroso-1,3-benzoxazol-2-yl)piperazine-1-carboxylate (PubChem CID 89200760) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is benzyl 4-(4-nitroso-1,3-benzoxazol-2-yl)piperazine-1-carboxylate.
| Compound Name | benzyl 4-(4-nitroso-1,3-benzoxazol-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 89200760 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | benzyl 4-(4-nitroso-1,3-benzoxazol-2-yl)piperazine-1-carboxylate |
| SMILES | O=Nc1cccc2oc(N3CCN(C(=O)OCc4ccccc4)CC3)nc12 |
| InChI | InChI=1S/C19H18N4O4/c24-19(26-13-14-5-2-1-3-6-14)23-11-9-22(10-12-23)18-20-17-15(21-25)7-4-8-16(17)27-18/h1-8H,9-13H2 |
| InChIKey | XKJNEHNSJKZVNR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |