C25H24ClFN4O4S — CID 89204540
[(3S)-3-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-3-(3-oxopropyl)thiiran-2-yl]methyl N-isoquinolin-3-ylcarbamate (PubChem CID 89204540) has the molecular formula C25H24ClFN4O4S and a molecular weight of 531.01 g/mol. Its IUPAC name is [(3S)-3-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-3-(3-oxopropyl)thiiran-2-yl]methyl N-isoquinolin-3-ylcarbamate.
| Compound Name | [(3S)-3-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-3-(3-oxopropyl)thiiran-2-yl]methyl N-isoquinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 89204540 |
| Molecular Formula | C25H24ClFN4O4S |
| Molecular Weight | 531.01 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | [(3S)-3-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-3-(3-oxopropyl)thiiran-2-yl]methyl N-isoquinolin-3-ylcarbamate |
| SMILES | CN(C(=O)NCc1cccc(F)c1Cl)[C@@]1(CCC=O)SC1COC(=O)Nc1cc2ccccc2cn1 |
| InChI | InChI=1S/C25H24ClFN4O4S/c1-31(23(33)29-14-18-8-4-9-19(27)22(18)26)25(10-5-11-32)20(36-25)15-35-24(34)30-21-12-16-6-2-3-7-17(16)13-28-21/h2-4,6-9,11-13,20H,5,10,14-15H2,1H3,(H,29,33)(H,28,30,34)/t20?,25-/m0/s1 |
| InChIKey | ANQREJDTGNRTRF-KUXBLMNESA-N |
| XLogP | 5.21 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.01 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|