C30H34F2N4O7S — CID 143763412
[(3S)-3-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-3-[4-(1,4-dihydroxy-3-oxobutan-2-yl)oxybutyl]thiiran-2-yl]methyl N-isoquinolin-3-ylcarbamate (PubChem CID 143763412) has the molecular formula C30H34F2N4O7S and a molecular weight of 632.69 g/mol. Its IUPAC name is [(3S)-3-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-3-[4-(1,4-dihydroxy-3-oxobutan-2-yl)oxybutyl]thiiran-2-yl]methyl N-isoquinolin-3-ylcarbamate.
| Compound Name | [(3S)-3-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-3-[4-(1,4-dihydroxy-3-oxobutan-2-yl)oxybutyl]thiiran-2-yl]methyl N-isoquinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 143763412 |
| Molecular Formula | C30H34F2N4O7S |
| Molecular Weight | 632.69 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | [(3S)-3-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-3-[4-(1,4-dihydroxy-3-oxobutan-2-yl)oxybutyl]thiiran-2-yl]methyl N-isoquinolin-3-ylcarbamate |
| SMILES | CN(C(=O)NCc1cccc(F)c1F)[C@@]1(CCCCOC(CO)C(=O)CO)SC1COC(=O)Nc1cc2ccccc2cn1 |
| InChI | InChI=1S/C30H34F2N4O7S/c1-36(28(40)34-15-21-9-6-10-22(31)27(21)32)30(11-4-5-12-42-24(17-38)23(39)16-37)25(44-30)18-43-29(41)35-26-13-19-7-2-3-8-20(19)14-33-26/h2-3,6-10,13-14,24-25,37-38H,4-5,11-12,15-18H2,1H3,(H,34,40)(H,33,35,41)/t24?,25?,30-/m0/s1 |
| InChIKey | AQSUALAENQNGCH-KBSXYSMTSA-N |
| XLogP | 3.82 |
| TPSA | 150.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.69 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|