C15H23NO — CID 89206449
N-[2-(2-bicyclo[2.2.1]heptanyl)cyclopentyl]prop-2-enamide (PubChem CID 89206449) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is N-[2-(2-bicyclo[2.2.1]heptanyl)cyclopentyl]prop-2-enamide.
| Compound Name | N-[2-(2-bicyclo[2.2.1]heptanyl)cyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 89206449 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-[2-(2-bicyclo[2.2.1]heptanyl)cyclopentyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCCC1C1CC2CCC1C2 |
| InChI | InChI=1S/C15H23NO/c1-2-15(17)16-14-5-3-4-12(14)13-9-10-6-7-11(13)8-10/h2,10-14H,1,3-9H2,(H,16,17) |
| InChIKey | GFIJZKISWMHMBW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|