C13H19NO — CID 43700056
N-(8-tricyclo[5.2.1.02,6]decanyl)prop-2-enamide (PubChem CID 43700056) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is N-(8-tricyclo[5.2.1.02,6]decanyl)prop-2-enamide.
| Compound Name | N-(8-tricyclo[5.2.1.02,6]decanyl)prop-2-enamide |
|---|---|
| PubChem CID | 43700056 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-(8-tricyclo[5.2.1.02,6]decanyl)prop-2-enamide |
| SMILES | C=CC(=O)NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C13H19NO/c1-2-13(15)14-12-7-8-6-11(12)10-5-3-4-9(8)10/h2,8-12H,1,3-7H2,(H,14,15) |
| InChIKey | UQIQMIBAXNOGFH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|