C26H29N9O — CID 89206523
1-[4-[4-[[4-[4-methanimidoyl-3-(methylamino)anilino]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone (PubChem CID 89206523) has the molecular formula C26H29N9O and a molecular weight of 483.58 g/mol. Its IUPAC name is 1-[4-[4-[[4-[4-methanimidoyl-3-(methylamino)anilino]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[[4-[4-methanimidoyl-3-(methylamino)anilino]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 89206523 |
| Molecular Formula | C26H29N9O |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 1-[4-[4-[[4-[4-methanimidoyl-3-(methylamino)anilino]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone |
| SMILES | [H]/N=C/c1ccc(Nc2nc(Nc3ccc(N4CCN(C(C)=O)CC4)cc3)nc3[nH]ccc23)cc1NC |
| InChI | InChI=1S/C26H29N9O/c1-17(36)34-11-13-35(14-12-34)21-7-5-19(6-8-21)31-26-32-24-22(9-10-29-24)25(33-26)30-20-4-3-18(16-27)23(15-20)28-2/h3-10,15-16,27-28H,11-14H2,1-2H3,(H3,29,30,31,32,33)/b27-16+ |
| InChIKey | MWDOSFHSYTXIJB-JVWAILMASA-N |
| XLogP | 4.15 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|