C14H20N6S — CID 143883179
4-methanimidoyl-1-N-(4-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl)benzene-1,3-diamine;molecular hydrogen (PubChem CID 143883179) has the molecular formula C14H20N6S and a molecular weight of 304.42 g/mol. Its IUPAC name is 4-methanimidoyl-1-N-(4-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl)benzene-1,3-diamine;molecular hydrogen.
| Compound Name | 4-methanimidoyl-1-N-(4-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl)benzene-1,3-diamine;molecular hydrogen |
|---|---|
| PubChem CID | 143883179 |
| Molecular Formula | C14H20N6S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 4-methanimidoyl-1-N-(4-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl)benzene-1,3-diamine;molecular hydrogen |
| SMILES | [H]/N=C/c1ccc(Nc2nc(SC)c3cc[nH]c3n2)cc1N.[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C14H14N6S.3H2/c1-21-13-10-4-5-17-12(10)19-14(20-13)18-9-3-2-8(7-15)11(16)6-9;;;/h2-7,15H,16H2,1H3,(H2,17,18,19,20);3*1H/b15-7+;;; |
| InChIKey | XRXSIJRAEROJHW-HFUUWOKWSA-N |
| XLogP | 3.74 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|