C18H21N7O — CID 167157728
2-methanimidoyl-4-N-[5-[4-[2-(methylamino)ethoxy]phenyl]-1H-1,2,4-triazol-3-yl]benzene-1,4-diamine (PubChem CID 167157728) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-methanimidoyl-4-N-[5-[4-[2-(methylamino)ethoxy]phenyl]-1H-1,2,4-triazol-3-yl]benzene-1,4-diamine.
| Compound Name | 2-methanimidoyl-4-N-[5-[4-[2-(methylamino)ethoxy]phenyl]-1H-1,2,4-triazol-3-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 167157728 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 2-methanimidoyl-4-N-[5-[4-[2-(methylamino)ethoxy]phenyl]-1H-1,2,4-triazol-3-yl]benzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2n[nH]c(-c3ccc(OCCNC)cc3)n2)ccc1N |
| InChI | InChI=1S/C18H21N7O/c1-21-8-9-26-15-5-2-12(3-6-15)17-23-18(25-24-17)22-14-4-7-16(20)13(10-14)11-19/h2-7,10-11,19,21H,8-9,20H2,1H3,(H2,22,23,24,25)/b19-11+ |
| InChIKey | VAWHSFNSXYGFES-YBFXNURJSA-N |
| XLogP | 2.39 |
| TPSA | 124.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|