C27H34N4O2S — CID 89206644
N-[1-[(2R)-1-(N-benzylsulfanylanilino)propan-2-yl]piperidin-4-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide (PubChem CID 89206644) has the molecular formula C27H34N4O2S and a molecular weight of 478.66 g/mol. Its IUPAC name is N-[1-[(2R)-1-(N-benzylsulfanylanilino)propan-2-yl]piperidin-4-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide.
| Compound Name | N-[1-[(2R)-1-(N-benzylsulfanylanilino)propan-2-yl]piperidin-4-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 89206644 |
| Molecular Formula | C27H34N4O2S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | N-[1-[(2R)-1-(N-benzylsulfanylanilino)propan-2-yl]piperidin-4-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
| SMILES | Cc1cc(CC(=O)NC2CCN([C@H](C)CN(SCc3ccccc3)c3ccccc3)CC2)on1 |
| InChI | InChI=1S/C27H34N4O2S/c1-21-17-26(33-29-21)18-27(32)28-24-13-15-30(16-14-24)22(2)19-31(25-11-7-4-8-12-25)34-20-23-9-5-3-6-10-23/h3-12,17,22,24H,13-16,18-20H2,1-2H3,(H,28,32)/t22-/m1/s1 |
| InChIKey | XICJYHOHYMEMFS-JOCHJYFZSA-N |
| XLogP | 4.85 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|