C10H17NO — CID 89208979
(1Z,3Z)-3-ethyl-5-(methoxymethyl)hexa-1,3,5-trien-1-amine (PubChem CID 89208979) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (1Z,3Z)-3-ethyl-5-(methoxymethyl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-3-ethyl-5-(methoxymethyl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89208979 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (1Z,3Z)-3-ethyl-5-(methoxymethyl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C(/C=C(\C=C/N)CC)COC |
| InChI | InChI=1S/C10H17NO/c1-4-10(5-6-11)7-9(2)8-12-3/h5-7H,2,4,8,11H2,1,3H3/b6-5-,10-7- |
| InChIKey | OMWVSZBPLNTNAC-ICZHLNMZSA-N |
| XLogP | 2.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|