C8H15NO — CID 129171438
(1Z,3E)-4-(methoxymethyl)hexa-1,3-dien-1-amine (PubChem CID 129171438) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (1Z,3E)-4-(methoxymethyl)hexa-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-4-(methoxymethyl)hexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 129171438 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (1Z,3E)-4-(methoxymethyl)hexa-1,3-dien-1-amine |
| SMILES | CC/C(=C\C=C/N)COC |
| InChI | InChI=1S/C8H15NO/c1-3-8(7-10-2)5-4-6-9/h4-6H,3,7,9H2,1-2H3/b6-4-,8-5+ |
| InChIKey | WPZSZWSTRVDPKP-QXMOYCCXSA-N |
| XLogP | 1.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|